| product Name |
4-Nitrobenzhydrazide |
| Synonyms |
4-Nitrobenzoic hydrazide; 4-Nireobenzoylhydrazine; 4-Nitrobenzoic acid hydrazide; 4-Nitrobenzoyl hydrazide; 2,5-dihydro-3H-imidazo[1,2-b]pyrazole; 4-nitrobenzohydrazide |
| Molecular Formula |
C7H7N3O3 |
| Molecular Weight |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-1-3-6(4-2-5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS Registry Number |
636-97-5 |
| EINECS |
211-271-1 |
| Molecular Structure |
|
| Density |
1.406g/cm3 |
| Melting point |
216-218℃ |
| Refractive index |
1.621 |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
