product Name |
2,5-dimethyl-3-furoic acid |
Synonyms |
2,5-Dimethyl-3-furoic acid; NSC 170612; 2,5-dimethylfuran-3-carboxylic acid; 2,5-dimethylfuran-3-carboxylate |
Molecular Formula |
C7H7O3 |
Molecular Weight |
139.1292 |
InChI |
InChI=1/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9)/p-1 |
CAS Registry Number |
636-44-2 |
EINECS |
211-257-5 |
Molecular Structure |
|
Melting point |
137-140℃ |
Boiling point |
240.6°C at 760 mmHg |
Flash point |
99.3°C |
Vapour Pressur |
0.0204mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|