| product Name |
2,5-dimethyl-3-furoic acid |
| Synonyms |
2,5-Dimethyl-3-furoic acid; NSC 170612; 2,5-dimethylfuran-3-carboxylic acid; 2,5-dimethylfuran-3-carboxylate |
| Molecular Formula |
C7H7O3 |
| Molecular Weight |
139.1292 |
| InChI |
InChI=1/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9)/p-1 |
| CAS Registry Number |
636-44-2 |
| EINECS |
211-257-5 |
| Molecular Structure |
|
| Melting point |
137-140℃ |
| Boiling point |
240.6°C at 760 mmHg |
| Flash point |
99.3°C |
| Vapour Pressur |
0.0204mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
