| product Name |
1,2,4,5-Tetrabromobenzene |
| Synonyms |
2,3,5,6-Tetrabromobenzene; NSC 27002; Benzene, 1,2,4,5-tetrabromo- |
| Molecular Formula |
C6H2Br4 |
| Molecular Weight |
393.6961 |
| InChI |
InChI=1/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
| CAS Registry Number |
636-28-2 |
| EINECS |
211-253-3 |
| Molecular Structure |
|
| Density |
2.553g/cm3 |
| Melting point |
180-182℃ |
| Boiling point |
327.5°C at 760 mmHg |
| Refractive index |
1.661 |
| Flash point |
148.5°C |
| Vapour Pressur |
0.000385mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
