product Name |
1,2,4,5-Tetrabromobenzene |
Synonyms |
2,3,5,6-Tetrabromobenzene; NSC 27002; Benzene, 1,2,4,5-tetrabromo- |
Molecular Formula |
C6H2Br4 |
Molecular Weight |
393.6961 |
InChI |
InChI=1/C6H2Br4/c7-3-1-4(8)6(10)2-5(3)9/h1-2H |
CAS Registry Number |
636-28-2 |
EINECS |
211-253-3 |
Molecular Structure |
|
Density |
2.553g/cm3 |
Melting point |
180-182℃ |
Boiling point |
327.5°C at 760 mmHg |
Refractive index |
1.661 |
Flash point |
148.5°C |
Vapour Pressur |
0.000385mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|