| product Name |
1-Phenylpyrrole |
| Synonyms |
(1-Pyrrolyl)benzene; 1-phenyl-1H-pyrrole |
| Molecular Formula |
C10H9N |
| Molecular Weight |
143.1852 |
| InChI |
InChI=1/C10H9N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9H |
| CAS Registry Number |
635-90-5 |
| EINECS |
211-242-3 |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Melting point |
58-60℃ |
| Boiling point |
234°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
95.3°C |
| Vapour Pressur |
0.0827mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
