| product Name |
2-(Carboxymethoxy)benzoic acid |
| Synonyms |
2-Carboxyphenoxyacetic acid |
| Molecular Formula |
C9H8O5 |
| Molecular Weight |
196.1568 |
| InChI |
InChI=1/C9H8O5/c10-8(11)5-14-7-4-2-1-3-6(7)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13) |
| CAS Registry Number |
635-53-0 |
| Molecular Structure |
|
| Density |
1.43g/cm3 |
| Boiling point |
411.9°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
170.9°C |
| Vapour Pressur |
1.59E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
