| product Name |
menthol, triester with orthoboric acid |
| Synonyms |
p-Menth-3-yl borate; Estoral; Menthyl borate; Cyclohexanol, 5-methyl-2-(1-methylethyl)-, 1,1',1''-triester with boric acid (H3BO3); Cyclohexanol, 5-methyl-2-(1-methylethyl)-, triester with boric acid (H3BO3); Menthol, triester with boric acid (H3BO3); Menthol, triester with orthoboric acid; tris[5-methyl-2-(1-methylethyl)cyclohexyl] borate |
| Molecular Formula |
C30H57BO3 |
| Molecular Weight |
476.5828 |
| InChI |
InChI=1/C30H57BO3/c1-19(2)25-13-10-22(7)16-28(25)32-31(33-29-17-23(8)11-14-26(29)20(3)4)34-30-18-24(9)12-15-27(30)21(5)6/h19-30H,10-18H2,1-9H3 |
| CAS Registry Number |
635-20-1 |
| EINECS |
211-229-2 |
| Molecular Structure |
|
| Density |
0.93g/cm3 |
| Boiling point |
493.6°C at 760 mmHg |
| Refractive index |
1.473 |
| Flash point |
183.3°C |
| Vapour Pressur |
2.1E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|