product Name |
1,4-Anthraquinone |
Synonyms |
1,4-Dioxoanthracene; 1,4-Anthracenedione; anthracene-1,4-dione |
Molecular Formula |
C14H8O2 |
Molecular Weight |
208.2121 |
InChI |
InChI=1/C14H8O2/c15-13-5-6-14(16)12-8-10-4-2-1-3-9(10)7-11(12)13/h1-8H |
CAS Registry Number |
635-12-1 |
EINECS |
211-228-7 |
Molecular Structure |
|
Density |
1.328g/cm3 |
Boiling point |
406°C at 760 mmHg |
Refractive index |
1.702 |
Flash point |
152°C |
Vapour Pressur |
8.39E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|