product Name |
Dicarbethoxydihydrocollidine |
Molecular Formula |
C14H21NO4 |
Molecular Weight |
267.3208 |
InChI |
InChI=1/C14H21NO4/c1-6-18-13(16)11-8(3)12(14(17)19-7-2)10(5)15-9(11)4/h8,11H,6-7H2,1-5H3/t8-,11?/m1/s1 |
CAS Registry Number |
632-93-9 |
EINECS |
211-188-0 |
Molecular Structure |
|
Density |
1.12g/cm3 |
Melting point |
139-132℃ |
Boiling point |
335°C at 760 mmHg |
Refractive index |
1.51 |
Flash point |
123.3°C |
Vapour Pressur |
0.000123mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|