product Name |
2-Nonanol |
Synonyms |
n-Heptyl methyl carbinol; nonan-2-ol |
Molecular Formula |
C9H20O |
Molecular Weight |
144.2545 |
InChI |
InChI=1/C9H20O/c1-3-4-5-6-7-8-9(2)10/h9-10H,3-8H2,1-2H3 |
CAS Registry Number |
628-99-9 |
EINECS |
211-065-1 |
Molecular Structure |
|
Density |
0.824g/cm3 |
Melting point |
-36℃ |
Boiling point |
195.5°C at 760 mmHg |
Refractive index |
1.43 |
Flash point |
82.2°C |
Vapour Pressur |
0.108mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|