| product Name |
1,4-Butanediol Diacetate |
| Synonyms |
Butanedioldiacetate; 1,4-Butylene Diacetate; 1,4-Diacetoxybutane; butane-1,4-diyl diacetate |
| Molecular Formula |
C8H14O4 |
| Molecular Weight |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-7(9)11-5-3-4-6-12-8(2)10/h3-6H2,1-2H3 |
| CAS Registry Number |
628-67-1 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Boiling point |
227.4°C at 760 mmHg |
| Refractive index |
1.422 |
| Flash point |
105.2°C |
| Vapour Pressur |
0.0777mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|