product Name |
Propargylacetate(Aceticacidpropargylester) |
Synonyms |
Propargyl acetate (Acetic acid propargyl ester); Propargyl acetate; Acetic acid propargyl ester~2-Propyn-1-yl acetate; prop-2-ynyl acetate |
Molecular Formula |
C5H6O2 |
Molecular Weight |
98.0999 |
InChI |
InChI=1/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
CAS Registry Number |
627-09-8 |
Molecular Structure |
|
Density |
0.997g/cm3 |
Boiling point |
122.4°C at 760 mmHg |
Refractive index |
1.418 |
Flash point |
28.3°C |
Vapour Pressur |
14mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|