| product Name |
(Ethylthio)acetic acid |
| Synonyms |
S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
| Molecular Formula |
C4H8O2S |
| Molecular Weight |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
| CAS Registry Number |
627-04-3 |
| EINECS |
210-979-8 |
| Molecular Structure |
|
| Density |
1.164g/cm3 |
| Boiling point |
229°C at 760 mmHg |
| Refractive index |
1.496 |
| Flash point |
92.3°C |
| Vapour Pressur |
0.0254mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
