| product Name |
Diacetamide |
| Synonyms |
diacetylamine; N-acetylacetamide |
| Molecular Formula |
C4H7NO2 |
| Molecular Weight |
101.1039 |
| InChI |
InChI=1/C4H7NO2/c1-3(6)5-4(2)7/h1-2H3,(H,5,6,7) |
| CAS Registry Number |
625-77-4 |
| EINECS |
210-910-1 |
| Molecular Structure |
|
| Density |
1.035g/cm3 |
| Melting point |
74-78℃ |
| Boiling point |
223.5°C at 760 mmHg |
| Refractive index |
1.41 |
| Flash point |
101.8°C |
| Vapour Pressur |
0.0959mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
