product Name |
2-Nitroethanol |
Synonyms |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
Molecular Formula |
C2H5NO3 |
Molecular Weight |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
CAS Registry Number |
625-48-9 |
EINECS |
210-895-1 |
Molecular Structure |
|
Density |
1.267g/cm3 |
Boiling point |
193.8°C at 760 mmHg |
Refractive index |
1.438 |
Flash point |
113.8°C |
Vapour Pressur |
0.12mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|