| product Name |
3-Nonanol |
| Synonyms |
Ethyl n-hexyl carbinol; nonan-3-ol; (3R)-nonan-3-ol; (3S)-nonan-3-ol |
| Molecular Formula |
C9H20O |
| Molecular Weight |
144.2545 |
| InChI |
InChI=1/C9H20O/c1-3-5-6-7-8-9(10)4-2/h9-10H,3-8H2,1-2H3/t9-/m0/s1 |
| CAS Registry Number |
624-51-1 |
| EINECS |
210-850-6 |
| Molecular Structure |
|
| Density |
0.824g/cm3 |
| Boiling point |
196.6°C at 760 mmHg |
| Refractive index |
1.43 |
| Flash point |
79.5°C |
| Vapour Pressur |
0.102mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
