| product Name |
Di-n-propyl sulphite |
| Molecular Formula |
C6H14O3S |
| Molecular Weight |
166.23 |
| InChI |
InChI=1/C6H14O3S/c1-3-5-8-10(7)9-6-4-2/h3-6H2,1-2H3 |
| CAS Registry Number |
623-98-3 |
| Molecular Structure |
|
| Density |
1.03 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
