product Name |
1,3-diethylurea |
Synonyms |
1,3-Diethylurea = N,N-Diethylurea |
Molecular Formula |
C5H12N2O |
Molecular Weight |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
CAS Registry Number |
623-76-7 |
EINECS |
210-811-3 |
Molecular Structure |
|
Density |
0.923g/cm3 |
Melting point |
112-113℃ |
Boiling point |
263°C at 760 mmHg |
Refractive index |
1.428 |
Flash point |
121.1°C |
Vapour Pressur |
0.0106mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|