| product Name |
Ethyl 2-mercaptoacetate |
| Synonyms |
Ethyl thioglycolate~Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl thioglycolate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
| Molecular Formula |
C4H8O2S |
| Molecular Weight |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
| CAS Registry Number |
623-51-8 |
| EINECS |
210-800-3 |
| Molecular Structure |
|
| Density |
1.072g/cm3 |
| Boiling point |
157.8°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
47.8°C |
| Vapour Pressur |
2.7mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|