| product Name |
3-Bromooctane |
| Synonyms |
Octane, 3-bromo- |
| Molecular Formula |
C8H17Br |
| Molecular Weight |
193.1246 |
| InChI |
InChI=1/C8H17Br/c1-3-5-6-7-8(9)4-2/h8H,3-7H2,1-2H3 |
| CAS Registry Number |
999-64-4 |
| EINECS |
213-664-3 |
| Molecular Structure |
|
| Density |
1.108g/cm3 |
| Boiling point |
190.8°C at 760 mmHg |
| Refractive index |
1.45 |
| Flash point |
56.1°C |
| Vapour Pressur |
0.739mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
