| product Name |
1-Chloro-4-ethylbenzene |
| Synonyms |
p-Ethylchlorobenzene |
| Molecular Formula |
C8H9Cl |
| Molecular Weight |
140.6101 |
| InChI |
InChI=1/C8H9Cl/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
622-98-0 |
| EINECS |
210-763-3 |
| Molecular Structure |
|
| Density |
1.047g/cm3 |
| Boiling point |
184.4°C at 760 mmHg |
| Refractive index |
1.518 |
| Flash point |
60°C |
| Vapour Pressur |
1.01mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
