| product Name |
3-Diethylamino-1-propanol |
| Molecular Formula |
C7H18NO |
| Molecular Weight |
132.2234 |
| InChI |
InChI=1/C7H17NO/c1-3-8(4-2)6-5-7-9/h9H,3-7H2,1-2H3/p+1 |
| CAS Registry Number |
622-93-5 |
| EINECS |
210-759-1 |
| Molecular Structure |
|
| Boiling point |
189.5°C at 760 mmHg |
| Flash point |
65.6°C |
| Vapour Pressur |
0.155mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S7:Keep container tightly closed.;
|
|
