product Name |
p-Tolylurea |
Synonyms |
4-Methylphenylurea; 1-(4-methylphenyl)urea |
Molecular Formula |
C8H10N2O |
Molecular Weight |
150.1778 |
InChI |
InChI=1/C8H10N2O/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
CAS Registry Number |
622-51-5 |
EINECS |
210-739-2 |
Molecular Structure |
|
Density |
1.192g/cm3 |
Melting point |
180-182℃ |
Boiling point |
255.1°C at 760 mmHg |
Refractive index |
1.62 |
Flash point |
108.1°C |
Vapour Pressur |
0.0166mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|