| product Name |
1,2-Bis(phenylthio)ethane |
| Synonyms |
1,2-Bis(phenylthio)ethane,98%; 1,1'-(ethane-1,2-diyldisulfanediyl)dibenzene |
| Molecular Formula |
C14H14S2 |
| Molecular Weight |
246.391 |
| InChI |
InChI=1/C14H14S2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| CAS Registry Number |
622-20-8 |
| EINECS |
210-723-5 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
377.3°C at 760 mmHg |
| Refractive index |
1.646 |
| Flash point |
184.6°C |
| Vapour Pressur |
1.48E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
