| product Name |
2,2-diethoxyethanol |
| Synonyms |
Hydroxyacetaldehyde diethyl acetal; 2,2-diethoxy ethanol; glycolaldehyde diethyl acetal |
| Molecular Formula |
C6H14O3 |
| Molecular Weight |
134.1736 |
| InChI |
InChI=1/C6H14O3/c1-3-8-6(5-7)9-4-2/h6-7H,3-5H2,1-2H3 |
| CAS Registry Number |
621-63-6 |
| EINECS |
210-697-5 |
| Molecular Structure |
|
| Density |
0.97g/cm3 |
| Boiling point |
167°C at 760 mmHg |
| Refractive index |
1.418 |
| Flash point |
68.4°C |
| Vapour Pressur |
0.574mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
