product Name |
3-(3-Hydroxyphenyl)propionic acid |
Synonyms |
3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
Molecular Formula |
C9H10O3 |
Molecular Weight |
166.1739 |
InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
CAS Registry Number |
621-54-5 |
EINECS |
210-692-8 |
Molecular Structure |
|
Density |
1.26g/cm3 |
Boiling point |
354.5°C at 760 mmHg |
Refractive index |
1.58 |
Flash point |
182.4°C |
Vapour Pressur |
1.23E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|