| product Name |
3-Ethoxybenzoic acid |
| Synonyms |
- |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| CAS Registry Number |
621-51-2 |
| EINECS |
210-690-7 |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Melting point |
136-140℃ |
| Boiling point |
305.7°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
124.1°C |
| Vapour Pressur |
0.000354mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
