| product Name |
1-Ethyl-3-phenylurea |
| Synonyms |
N-Ethyl-N-phenylurea |
| Molecular Formula |
C9H12N2O |
| Molecular Weight |
164.2044 |
| InChI |
InChI=1/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,11,12) |
| CAS Registry Number |
621-04-5 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Boiling point |
250.2°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
102°C |
| Vapour Pressur |
0.0219mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
