| product Name |
Ethyl 2-benzylacetoacetate |
| Synonyms |
2-Benzylacetoacetic acid ethyl ester; ethyl 2-benzyl-3-oxobutanoate; ethyl (2S)-2-benzyl-3-oxobutanoate; ethyl (2R)-2-benzyl-3-oxobutanoate |
| Molecular Formula |
C13H16O3 |
| Molecular Weight |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/t12-/m1/s1 |
| CAS Registry Number |
620-79-1 |
| EINECS |
210-651-4 |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
276°C at 760 mmHg |
| Refractive index |
1.502 |
| Flash point |
132.3°C |
| Vapour Pressur |
0.00493mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
