| product Name |
2,6-Dichloroindophenol, sodium salt hydrate |
| Synonyms |
2,6-Dichlorophenolindophenol sodium salt hydrate~Sodium 2,5-dichloroindophenoxide hydrate; Tillmans; 2,6-Dichloroindophenol sodium salt hydrate; sodium 2,6-dichloroindophenolate hydrate; sodium 4-(3,5-dichloro-4-oxocyclohexa-2,5-dienylideneamino)phenoxide; Phenol-indo-2,6-dichlorophenol sodium salt; sodium 2,6-dichloro-4-[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate; sodium 4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate |
| Molecular Formula |
C12H6Cl2NNaO2 |
| Molecular Weight |
290.0773 |
| InChI |
InChI=1/C12H7Cl2NO2.Na/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;/h1-6,16H;/q;+1/p-1 |
| CAS Registry Number |
620-45-1 |
| EINECS |
210-640-4 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|