| product Name |
N,N-Dimethyl-3-nitroaniline |
| Synonyms |
3-Nitro-N,N-dimethylaniline; Benzenamine, N,N-dimethyl-3-nitro- |
| Molecular Formula |
C8H10N2O2 |
| Molecular Weight |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-9(2)7-4-3-5-8(6-7)10(11)12/h3-6H,1-2H3 |
| CAS Registry Number |
619-31-8 |
| EINECS |
210-590-3 |
| Molecular Structure |
|
| Density |
1.193g/cm3 |
| Melting point |
57-61℃ |
| Boiling point |
282.5°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
117°C |
| Vapour Pressur |
0.00334mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|