product Name |
N,N-Dimethyl-3-nitroaniline |
Synonyms |
3-Nitro-N,N-dimethylaniline; Benzenamine, N,N-dimethyl-3-nitro- |
Molecular Formula |
C8H10N2O2 |
Molecular Weight |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-9(2)7-4-3-5-8(6-7)10(11)12/h3-6H,1-2H3 |
CAS Registry Number |
619-31-8 |
EINECS |
210-590-3 |
Molecular Structure |
|
Density |
1.193g/cm3 |
Melting point |
57-61℃ |
Boiling point |
282.5°C at 760 mmHg |
Refractive index |
1.591 |
Flash point |
117°C |
Vapour Pressur |
0.00334mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|