product Name |
3-Nitrobenzhydrazide |
Synonyms |
3-nitrobenzohydrazide |
Molecular Formula |
C7H7N3O3 |
Molecular Weight |
181.1488 |
InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
CAS Registry Number |
618-94-0 |
EINECS |
210-572-5 |
Molecular Structure |
|
Density |
1.406g/cm3 |
Melting point |
153-154℃ |
Refractive index |
1.621 |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|