product Name |
4-Bromoheptane |
Synonyms |
Heptane, 4-bromo- |
Molecular Formula |
C7H15Br |
Molecular Weight |
179.098 |
InChI |
InChI=1/C7H15Br/c1-3-5-7(8)6-4-2/h7H,3-6H2,1-2H3 |
CAS Registry Number |
998-93-6 |
EINECS |
213-653-3 |
Molecular Structure |
|
Density |
1.136g/cm3 |
Boiling point |
168°C at 760 mmHg |
Refractive index |
1.447 |
Flash point |
48.4°C |
Vapour Pressur |
2.18mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R10:Flammable.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|