| product Name |
Ethyl 3-ethoxy-2-butenoate |
| Synonyms |
3-Ethoxy-2-butenoic acid ethyl ester~Ethyl 3-ethoxycrotonate; ethyl 3-ethoxybut-2-enoate |
| Molecular Formula |
C8H14O3 |
| Molecular Weight |
158.195 |
| InChI |
InChI=1/C8H14O3/c1-4-10-7(3)6-8(9)11-5-2/h6H,4-5H2,1-3H3 |
| CAS Registry Number |
998-91-4 |
| EINECS |
213-652-8 |
| Molecular Structure |
|
| Density |
0.965g/cm3 |
| Melting point |
30℃ |
| Boiling point |
209.5°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
58.3°C |
| Vapour Pressur |
0.203mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
