| product Name |
4-chloro-N'-hydroxybenzenecarboximidamide |
| Synonyms |
(Z)-4-chloro-N'-hydroxybenzamidine |
| Molecular Formula |
C7H7ClN2O |
| Molecular Weight |
170.5963 |
| InChI |
InChI=1/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H,(H2,9,10) |
| CAS Registry Number |
5033-28-3 |
| Molecular Structure |
|
| Density |
1.368g/cm3 |
| Melting point |
129℃ |
| Boiling point |
334.619°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
156.172°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|