| product Name |
Tri-n-propylsilane |
| Synonyms |
Silane, tripropyl-; NSC 96837; Tripropylsilane; tripropylsilyl |
| Molecular Formula |
C9H21Si |
| Molecular Weight |
157.3485 |
| InChI |
InChI=1/C9H21Si/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3 |
| CAS Registry Number |
998-29-8 |
| EINECS |
213-649-1 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|