| product Name |
Isopropyl n-propyl sulphide |
| Synonyms |
Isopropyl n-propyl sulfide; n-Propyl isopropyl sulphide; 1-(propan-2-ylsulfanyl)propane |
| Molecular Formula |
C6H14S |
| Molecular Weight |
118.2404 |
| InChI |
InChI=1/C6H14S/c1-4-5-7-6(2)3/h6H,4-5H2,1-3H3 |
| CAS Registry Number |
5008-73-1 |
| EINECS |
225-686-0 |
| Molecular Structure |
|
| Density |
0.833g/cm3 |
| Boiling point |
134.3°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
23°C |
| Vapour Pressur |
10.1mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
