| product Name |
3-Methyl-1,2-butadiene |
| Synonyms |
3,3-Dimethylallene; 3-methylbuta-1,2-diene |
| Molecular Formula |
C5H8 |
| Molecular Weight |
68.117 |
| InChI |
InChI=1/C5H8/c1-4-5(2)3/h1H2,2-3H3 |
| CAS Registry Number |
598-25-4 |
| EINECS |
209-926-1 |
| Molecular Structure |
|
| Density |
0.651g/cm3 |
| Boiling point |
43.3°C at 760 mmHg |
| Refractive index |
1.389 |
| Vapour Pressur |
391mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S33:Take precautionary measures against static discharges.;
|
|
