| product Name |
4',5'-Dibromofluorescein |
| Synonyms |
C.I. 45370:1; C.I. Solvent Red 72; D & C Orange no. 5; 4,5-Dibromo-3,6-dihydroxyspiro[isobenzofuran-1(3H),9-[9H]xanthen]-3-one; C.I. 45370.1; Solvent Red 72; 4',5'-dibromo-3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one; 2-[(9R,9aR)-4,5-dibromo-6-hydroxy-3-oxo-9,9a-dihydro-3H-xanthen-9-yl]benzoic acid |
| Molecular Formula |
C20H12Br2O5 |
| Molecular Weight |
492.1143 |
| InChI |
InChI=1/C20H12Br2O5/c21-16-13(23)7-5-11-15(9-3-1-2-4-10(9)20(25)26)12-6-8-14(24)17(22)19(12)27-18(11)16/h1-8,11,15,24H,(H,25,26)/t11-,15+/m1/s1 |
| CAS Registry Number |
596-03-2 |
| EINECS |
209-876-0 |
| Molecular Structure |
|
| Density |
1.96g/cm3 |
| Melting point |
270-273℃ |
| Boiling point |
540.4°C at 760 mmHg |
| Refractive index |
1.771 |
| Flash point |
280.6°C |
| Vapour Pressur |
1.65E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|