| product Name |
N-iso-Butylurea |
| Synonyms |
N-Isobutylurea; 1-(2-methylpropyl)urea |
| Molecular Formula |
C5H12N2O |
| Molecular Weight |
116.1616 |
| InChI |
InChI=1/C5H12N2O/c1-4(2)3-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8) |
| CAS Registry Number |
592-17-6 |
| Molecular Structure |
|
| Density |
0.959g/cm3 |
| Boiling point |
171.5°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
57.5°C |
| Vapour Pressur |
1.4mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
