| product Name |
Isobutyl isothiocyanate |
| Synonyms |
Isothiocyanic acid, isobutyl ester; 1-Isothiocyanato-2-methylpropane; 2-Methylpropyl isothiocyanate; 4-04-00-00653 (Beilstein Handbook Reference); BRN 1740371; EINECS 209-733-2; i-Butyl isothiocyanate; Propane, 1-isothiocyanato-2-methyl- (9CI) |
| Molecular Formula |
C5H9NS |
| Molecular Weight |
115.1967 |
| InChI |
InChI=1/C5H9NS/c1-5(2)3-6-4-7/h5H,3H2,1-2H3 |
| CAS Registry Number |
591-82-2 |
| EINECS |
209-733-2 |
| Molecular Structure |
|
| Density |
0.92g/cm3 |
| Boiling point |
163.3°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
44.2°C |
| Vapour Pressur |
2.72mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
