| product Name |
N-Acetylthiourea |
| Synonyms |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
| Molecular Formula |
C3H6N2OS |
| Molecular Weight |
118.1575 |
| InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| CAS Registry Number |
591-08-2 |
| EINECS |
209-699-9 |
| Molecular Structure |
|
| Density |
1.275g/cm3 |
| Melting point |
166-168℃ |
| Boiling point |
208.6°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
80°C |
| Vapour Pressur |
0.212mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
