| product Name |
1,1-Dimethylcyclohexane |
| Synonyms |
AI3-28793; NSC 74156; gem-Dimethylcyclohexane; Cyclohexane, 1,1-dimethyl- |
| Molecular Formula |
C8H16 |
| Molecular Weight |
112.21 |
| InChI |
InChI=1/C8H16/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3 |
| CAS Registry Number |
590-66-9 |
| EINECS |
209-687-3 |
| Molecular Structure |
|
| Density |
0.77 |
| Boiling point |
118-120℃ |
| Refractive index |
1.428-1.423 |
| Flash point |
7℃ |
| Hazard Symbols |
 F:Highly flammable;
 Xi:Irritant;
|
| Risk Codes |
R11:Highly flammable.;
R38:Irritating to skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|
