product Name |
4-octanol |
Synonyms |
n-Butyl n-propyl carbinol; octan-4-ol |
Molecular Formula |
C8H18O |
Molecular Weight |
130.2279 |
InChI |
InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
CAS Registry Number |
589-62-8 |
EINECS |
209-654-3 |
Molecular Structure |
|
Density |
0.821g/cm3 |
Boiling point |
179.2°C at 760 mmHg |
Refractive index |
1.426 |
Flash point |
71.1°C |
Vapour Pressur |
0.284mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|