| product Name |
Diethyl chlorophosphite |
| Synonyms |
Diethyl chlorophosphonite; Diethyl phosphorochloridite; Ethyl phosphorochloridite; diethyl phosphorochloridoite |
| Molecular Formula |
C4H10ClO2P |
| Molecular Weight |
156.5478 |
| InChI |
InChI=1/C4H10ClO2P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| CAS Registry Number |
589-57-1 |
| EINECS |
209-652-2 |
| Molecular Structure |
|
| Boiling point |
154°C at 760 mmHg |
| Flash point |
1.1°C |
| Vapour Pressur |
4.17mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
