| product Name |
4-(4-Fluorophenyl)butyric acid |
| Synonyms |
4-(p-Fluorophenyl)butyric acid; 4-(4-fluorophenyl)butanoate |
| Molecular Formula |
C10H10FO2 |
| Molecular Weight |
181.1842 |
| InChI |
InChI=1/C10H11FO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)/p-1 |
| CAS Registry Number |
589-06-0 |
| EINECS |
209-631-8 |
| Molecular Structure |
|
| Melting point |
38℃ |
| Boiling point |
296.5°C at 760 mmHg |
| Flash point |
133.1°C |
| Vapour Pressur |
0.000646mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
