| product Name |
benzaldehyde azine |
| Synonyms |
Benzaldehyde azine, (Benzalazine); Benzalazine,98%; Benzalazine; Benzylideneazine; dibenzylidenehydrazine |
| Molecular Formula |
C14H12N2 |
| Molecular Weight |
208.2585 |
| InChI |
InChI=1/C14H12N2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-12H |
| CAS Registry Number |
588-68-1 |
| EINECS |
209-627-6 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
318.3°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
138.3°C |
| Vapour Pressur |
0.000681mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
