| product Name |
tributyl orthoformate |
| Synonyms |
1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
| Molecular Formula |
C13H28O3 |
| Molecular Weight |
232.3596 |
| InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
| CAS Registry Number |
588-43-2 |
| EINECS |
209-618-7 |
| Molecular Structure |
|
| Density |
0.884g/cm3 |
| Boiling point |
262.7°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
96.3°C |
| Vapour Pressur |
0.0175mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|