product Name |
N,N'-Bis-(4-nitrophenyl)urea |
Synonyms |
1,3-Bis(4-nitrophenyl)urea; 4,4-Dinitrocarbanilide |
Molecular Formula |
C13H10N4O5 |
Molecular Weight |
302.2423 |
InChI |
InChI=1/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
CAS Registry Number |
587-90-6 |
EINECS |
209-607-7 |
Molecular Structure |
|
Density |
1.561g/cm3 |
Boiling point |
414.8°C at 760 mmHg |
Refractive index |
1.741 |
Flash point |
204.7°C |
Vapour Pressur |
4.32E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|