| product Name |
3-Ethylaniline |
| Synonyms |
3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
| Molecular Formula |
C8H11N |
| Molecular Weight |
121.1796 |
| InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| CAS Registry Number |
587-02-0 |
| EINECS |
209-594-8 |
| Molecular Structure |
|
| Density |
0.973g/cm3 |
| Melting point |
-8℃ |
| Boiling point |
216.6°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
85°C |
| Vapour Pressur |
0.139mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
