| product Name |
1,2-Dimethylcyclohexane |
| Synonyms |
1,2-Dimethylcyclohexane (cis+trans); (1R,2R)-1,2-dimethylcyclohexane |
| Molecular Formula |
C8H16 |
| Molecular Weight |
112.2126 |
| InChI |
InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| CAS Registry Number |
583-57-3 |
| EINECS |
209-509-4 |
| Molecular Structure |
|
| Density |
0.766g/cm3 |
| Boiling point |
125.9°C at 760 mmHg |
| Refractive index |
1.42 |
| Flash point |
15.6°C |
| Vapour Pressur |
14.5mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
|
| Risk Codes |
R11:Highly flammable.;
R38:Irritating to skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|
